Nervonic Acid

max at gmail dot com

Synonyms: (Z)-15-Tetracosaenoic Acid; Selacholeic acid; cis-15-Tetracosenoic acid;

Source: From Malania oleifera fruits

Formula: CH3(CH2)7CH=CH(CH2)13COOH (cis)

Molecular: 366.62

CAS Registry Number: 506-37-6

Description: White crystalline powder

Content: 90%min

Packing: 0.5kg, 1kg or customized

Fuction and Application:

1. Increase protein of brain

2. Improve memory

3. Anti-aging

4. Decrease the blood fat.

5. Can be used for formula milk powder and health care capsule